C12H14ClN — CID 71541287
3-(4-chlorophenyl)-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 71541287) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,3,4,7-tetrahydro-1H-azepine.
| Compound Name | 3-(4-chlorophenyl)-2,3,4,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 71541287 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-(4-chlorophenyl)-2,3,4,7-tetrahydro-1H-azepine |
| SMILES | Clc1ccc(C2CC=CCNC2)cc1 |
| InChI | InChI=1S/C12H14ClN/c13-12-6-4-10(5-7-12)11-3-1-2-8-14-9-11/h1-2,4-7,11,14H,3,8-9H2 |
| InChIKey | IGHNBPCIIFLLHN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|