C14H15NO — CID 71541289
3-(1-benzofuran-2-yl)-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 71541289) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-2,3,4,7-tetrahydro-1H-azepine.
| Compound Name | 3-(1-benzofuran-2-yl)-2,3,4,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 71541289 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-2,3,4,7-tetrahydro-1H-azepine |
| SMILES | C1=CCC(c2cc3ccccc3o2)CNC1 |
| InChI | InChI=1S/C14H15NO/c1-2-7-13-11(5-1)9-14(16-13)12-6-3-4-8-15-10-12/h1-5,7,9,12,15H,6,8,10H2 |
| InChIKey | IHFKHNCURWJDHC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|