C18H32N4O — CID 71541381
N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-phenylacetamide (PubChem CID 71541381) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-phenylacetamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 71541381 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-phenylacetamide |
| SMILES | NCCCNCCCCNCCCNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H32N4O/c19-10-6-13-20-11-4-5-12-21-14-7-15-22-18(23)16-17-8-2-1-3-9-17/h1-3,8-9,20-21H,4-7,10-16,19H2,(H,22,23) |
| InChIKey | VIZFYBXTUUVQPR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|