C28H34N2O5 — CID 71541404
4-hydroxy-3-(3-methylbutyl)-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]benzamide (PubChem CID 71541404) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-hydroxy-3-(3-methylbutyl)-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]benzamide.
| Compound Name | 4-hydroxy-3-(3-methylbutyl)-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]benzamide |
|---|---|
| PubChem CID | 71541404 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 4-hydroxy-3-(3-methylbutyl)-N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]benzamide |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(NC(=O)c3ccc(O)c(CCC(C)C)c3)c(=O)oc12 |
| InChI | InChI=1S/C28H34N2O5/c1-17(2)5-6-19-15-21(7-9-24(19)31)27(32)29-23-16-20-8-10-25(18(3)26(20)35-28(23)33)34-22-11-13-30(4)14-12-22/h7-10,15-17,22,31H,5-6,11-14H2,1-4H3,(H,29,32) |
| InChIKey | QEBCRXLOLHSCAR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|