C13H15ClFN4O6P — CID 71541749
1-[(4aR,6R,7R,7aR)-7-(2-chloroethynyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-1,3,5-triazin-2-one (PubChem CID 71541749) has the molecular formula C13H15ClFN4O6P and a molecular weight of 408.71 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aR)-7-(2-chloroethynyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-1,3,5-triazin-2-one.
| Compound Name | 1-[(4aR,6R,7R,7aR)-7-(2-chloroethynyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 71541749 |
| Molecular Formula | C13H15ClFN4O6P |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 1-[(4aR,6R,7R,7aR)-7-(2-chloroethynyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-1,3,5-triazin-2-one |
| SMILES | CC(C)OP1(=O)OC[C@H]2O[C@@H](n3cnc(N)nc3=O)[C@@](F)(C#CCl)[C@@H]2O1 |
| InChI | InChI=1S/C13H15ClFN4O6P/c1-7(2)24-26(21)22-5-8-9(25-26)13(15,3-4-14)10(23-8)19-6-17-11(16)18-12(19)20/h6-10H,5H2,1-2H3,(H2,16,18,20)/t8-,9-,10-,13-,26?/m1/s1 |
| InChIKey | BFMZHNZOCWMUQZ-QUPUIKQFSA-N |
| XLogP | 0.97 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|