C22H35N3O6S2 — CID 71542507
(1S,5S,6R,9S,15E,20R)-5-hydroxy-6,20-di(propan-2-yl)-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone (PubChem CID 71542507) has the molecular formula C22H35N3O6S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is (1S,5S,6R,9S,15E,20R)-5-hydroxy-6,20-di(propan-2-yl)-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone.
| Compound Name | (1S,5S,6R,9S,15E,20R)-5-hydroxy-6,20-di(propan-2-yl)-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
|---|---|
| PubChem CID | 71542507 |
| Molecular Formula | C22H35N3O6S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | (1S,5S,6R,9S,15E,20R)-5-hydroxy-6,20-di(propan-2-yl)-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
| SMILES | CC(C)[C@H]1NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](C(C)C)C(=O)N2)OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C22H35N3O6S2/c1-12(2)19-16(26)10-18(28)31-14-7-5-6-8-32-33-11-15(21(29)25-19)23-22(30)20(13(3)4)24-17(27)9-14/h5,7,12-16,19-20,26H,6,8-11H2,1-4H3,(H,23,30)(H,24,27)(H,25,29)/b7-5+/t14-,15-,16+,19-,20-/m1/s1 |
| InChIKey | JZQMKISCWGGSJZ-LUUCZSADSA-N |
| XLogP | 1.16 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|