C19H28N4O6S2 — CID 71542508
(1S,10S,16E,21R)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone (PubChem CID 71542508) has the molecular formula C19H28N4O6S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is (1S,10S,16E,21R)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone.
| Compound Name | (1S,10S,16E,21R)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 71542508 |
| Molecular Formula | C19H28N4O6S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (1S,10S,16E,21R)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| SMILES | CC(C)[C@H]1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC1=O)C(=O)NCC(=O)NCC(=O)O2 |
| InChI | InChI=1S/C19H28N4O6S2/c1-11(2)17-19(28)22-13-10-31-30-6-4-3-5-12(7-14(24)23-17)29-16(26)9-20-15(25)8-21-18(13)27/h3,5,11-13,17H,4,6-10H2,1-2H3,(H,20,25)(H,21,27)(H,22,28)(H,23,24)/b5-3+/t12-,13-,17-/m1/s1 |
| InChIKey | FTXPGTDKAFEPGS-XWDUBYFRSA-N |
| XLogP | -0.50 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|