C26H34N4O6S2 — CID 71542604
(1S,7S,10S,16E,21R)-7-benzyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone (PubChem CID 71542604) has the molecular formula C26H34N4O6S2 and a molecular weight of 562.71 g/mol. Its IUPAC name is (1S,7S,10S,16E,21R)-7-benzyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone.
| Compound Name | (1S,7S,10S,16E,21R)-7-benzyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 71542604 |
| Molecular Formula | C26H34N4O6S2 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | (1S,7S,10S,16E,21R)-7-benzyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| SMILES | CC(C)[C@H]1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC1=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)O2 |
| InChI | InChI=1S/C26H34N4O6S2/c1-16(2)23-26(35)29-20-15-38-37-11-7-6-10-18(13-21(31)30-23)36-22(32)14-27-24(33)19(28-25(20)34)12-17-8-4-3-5-9-17/h3-6,8-10,16,18-20,23H,7,11-15H2,1-2H3,(H,27,33)(H,28,34)(H,29,35)(H,30,31)/b10-6+/t18-,19+,20-,23-/m1/s1 |
| InChIKey | RTUUWGNYWYQPCL-PVDTTYOVSA-N |
| XLogP | 1.11 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|