About 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline
2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline (PubChem CID 71542890) has the molecular formula C18H16ClN3O
and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline.
Molecular Properties
| Compound Name | 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline |
| PubChem CID | 71542890 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline |
| SMILES | COc1ccc2c(c1)CCCN2c1nc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C18H16ClN3O/c1-23-13-8-9-16-12(11-13)5-4-10-22(16)17-14-6-2-3-7-15(14)20-18(19)21-17/h2-3,6-9,11H,4-5,10H2,1H3 |
| InChIKey | BJGUNGDUBFAZJF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline?
The IUPAC name of 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline (CID 71542890) is 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline.
What is the SMILES notation for 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline?
The canonical SMILES for 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline is COc1ccc2c(c1)CCCN2c1nc(Cl)nc2ccccc12.
What is the InChIKey of 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline?
The InChIKey is BJGUNGDUBFAZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3O/c1-23-13-8-9-16-12(11-13)5-4-10-22(16)17-14-6-2-3-7-15(14)20-18(19)21-17/h2-3,6-9,11H,4-5,10H2,1H3.
What are the key properties of 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline?
2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline has a molecular weight of 325.80 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)quinazoline is sourced from PubChem (CID 71542890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).