About 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone
2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone (PubChem CID 71542931) has the molecular formula C24H19N3O3
and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone.
Molecular Properties
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone |
| PubChem CID | 71542931 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone |
| SMILES | COc1cccc(NC(C(=O)c2c[nH]c3ccccc23)c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C24H19N3O3/c1-29-16-8-6-7-15(13-16)26-22(24-27-20-11-4-5-12-21(20)30-24)23(28)18-14-25-19-10-3-2-9-17(18)19/h2-14,22,25-26H,1H3 |
| InChIKey | KJNJXOKOFHFGOP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone?
The IUPAC name of 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone (CID 71542931) is 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone.
What is the SMILES notation for 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone?
The canonical SMILES for 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone is COc1cccc(NC(C(=O)c2c[nH]c3ccccc23)c2nc3ccccc3o2)c1.
What is the InChIKey of 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone?
The InChIKey is KJNJXOKOFHFGOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O3/c1-29-16-8-6-7-15(13-16)26-22(24-27-20-11-4-5-12-21(20)30-24)23(28)18-14-25-19-10-3-2-9-17(18)19/h2-14,22,25-26H,1H3.
What are the key properties of 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone?
2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone has a molecular weight of 397.43 g/mol, XLogP of 5.35, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-2-yl)-1-(1H-indol-3-yl)-2-(3-methoxyanilino)ethanone is sourced from PubChem (CID 71542931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).