About 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine
1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine (PubChem CID 71543346) has the molecular formula C16H16F3N3
and a molecular weight of 307.32 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine.
Molecular Properties
| Compound Name | 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine |
| PubChem CID | 71543346 |
| Molecular Formula | C16H16F3N3 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3N3/c1-10-7-11(2)9-12(8-10)21-15(20)22-14-6-4-3-5-13(14)16(17,18)19/h3-9H,1-2H3,(H3,20,21,22) |
| InChIKey | DVIJFJSZZNOTLP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine?
The IUPAC name of 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine (CID 71543346) is 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine.
What is the SMILES notation for 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine?
The canonical SMILES for 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine is Cc1cc(C)cc(N/C(N)=N/c2ccccc2C(F)(F)F)c1.
What is the InChIKey of 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine?
The InChIKey is DVIJFJSZZNOTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3N3/c1-10-7-11(2)9-12(8-10)21-15(20)22-14-6-4-3-5-13(14)16(17,18)19/h3-9H,1-2H3,(H3,20,21,22).
What are the key properties of 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine?
1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine has a molecular weight of 307.32 g/mol, XLogP of 4.38, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylphenyl)-2-[2-(trifluoromethyl)phenyl]guanidine is sourced from PubChem (CID 71543346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).