C14H10F3IO4S — CID 71543609
4-methoxy-8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene;trifluoromethanesulfonate (PubChem CID 71543609) has the molecular formula C14H10F3IO4S and a molecular weight of 458.20 g/mol. Its IUPAC name is 4-methoxy-8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene;trifluoromethanesulfonate.
| Compound Name | 4-methoxy-8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71543609 |
| Molecular Formula | C14H10F3IO4S |
| Molecular Weight | 458.20 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | 4-methoxy-8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene;trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)-c1ccccc1[I+]2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H10IO.CHF3O3S/c1-15-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13;2-1(3,4)8(5,6)7/h2-8H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | BMYDYUOMKZYAMN-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|