About 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole
2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole (PubChem CID 71543736) has the molecular formula C21H23N5OS
and a molecular weight of 393.52 g/mol. Its IUPAC name is 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole |
| PubChem CID | 71543736 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole |
| SMILES | CCOc1nc(CCc2nc(-c3nccs3)cn2C)nc2c(C)ccc(C)c12 |
| InChI | InChI=1S/C21H23N5OS/c1-5-27-20-18-13(2)6-7-14(3)19(18)24-16(25-20)8-9-17-23-15(12-26(17)4)21-22-10-11-28-21/h6-7,10-12H,5,8-9H2,1-4H3 |
| InChIKey | RSWMWDNKGUBQHI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole?
The IUPAC name of 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole (CID 71543736) is 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole.
What is the SMILES notation for 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole?
The canonical SMILES for 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole is CCOc1nc(CCc2nc(-c3nccs3)cn2C)nc2c(C)ccc(C)c12.
What is the InChIKey of 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole?
The InChIKey is RSWMWDNKGUBQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5OS/c1-5-27-20-18-13(2)6-7-14(3)19(18)24-16(25-20)8-9-17-23-15(12-26(17)4)21-22-10-11-28-21/h6-7,10-12H,5,8-9H2,1-4H3.
What are the key properties of 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole?
2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole has a molecular weight of 393.52 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(4-ethoxy-5,8-dimethylquinazolin-2-yl)ethyl]-1-methylimidazol-4-yl]-1,3-thiazole is sourced from PubChem (CID 71543736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).