About azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+)
azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) (PubChem CID 71543850) has the molecular formula C12H25N3O4Pt
and a molecular weight of 470.43 g/mol. Its IUPAC name is azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+).
Molecular Properties
| Compound Name | azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) |
| PubChem CID | 71543850 |
| Molecular Formula | C12H25N3O4Pt |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) |
| SMILES | N.N.O=C([O-])CC(CCCN1CCCCC1)C(=O)[O-].[Pt+2] |
| InChI | InChI=1S/C12H21NO4.2H3N.Pt/c14-11(15)9-10(12(16)17)5-4-8-13-6-2-1-3-7-13;;;/h10H,1-9H2,(H,14,15)(H,16,17);2*1H3;/q;;;+2/p-2 |
| InChIKey | FNKUFXZYCGYHIA-UHFFFAOYSA-L |
| XLogP | -0.92 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+)?
The IUPAC name of azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) (CID 71543850) is azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+).
What is the SMILES notation for azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+)?
The canonical SMILES for azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) is N.N.O=C([O-])CC(CCCN1CCCCC1)C(=O)[O-].[Pt+2].
What is the InChIKey of azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+)?
The InChIKey is FNKUFXZYCGYHIA-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H21NO4.2H3N.Pt/c14-11(15)9-10(12(16)17)5-4-8-13-6-2-1-3-7-13;;;/h10H,1-9H2,(H,14,15)(H,16,17);2*1H3;/q;;;+2/p-2.
What are the key properties of azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+)?
azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) has a molecular weight of 470.43 g/mol, XLogP of -0.92, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(3-piperidin-1-ylpropyl)butanedioate;platinum(2+) is sourced from PubChem (CID 71543850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).