C25H21ClF3N3O2 — CID 71544127
2-chloro-N-[4-[[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide (PubChem CID 71544127) has the molecular formula C25H21ClF3N3O2 and a molecular weight of 487.91 g/mol. Its IUPAC name is 2-chloro-N-[4-[[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-[[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71544127 |
| Molecular Formula | C25H21ClF3N3O2 |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 2-chloro-N-[4-[[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylidene]cyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCC(=Cc2cccc(Oc3ccc(C(F)(F)F)cn3)c2)CC1)c1cccnc1Cl |
| InChI | InChI=1S/C25H21ClF3N3O2/c26-23-21(5-2-12-30-23)24(33)32-19-9-6-16(7-10-19)13-17-3-1-4-20(14-17)34-22-11-8-18(15-31-22)25(27,28)29/h1-5,8,11-15,19H,6-7,9-10H2,(H,32,33)/b16-13- |
| InChIKey | PWQQVDGCCSBYQT-SSZFMOIBSA-N |
| XLogP | 6.70 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|