C23H32N6O2S — CID 71544314
4-[7-[(4-aminocyclohexyl)methyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide (PubChem CID 71544314) has the molecular formula C23H32N6O2S and a molecular weight of 456.62 g/mol. Its IUPAC name is 4-[7-[(4-aminocyclohexyl)methyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide.
| Compound Name | 4-[7-[(4-aminocyclohexyl)methyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 71544314 |
| Molecular Formula | C23H32N6O2S |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-[7-[(4-aminocyclohexyl)methyl]-2-(butylamino)pyrrolo[2,3-d]pyrimidin-5-yl]benzenesulfonamide |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(N)(=O)=O)cc3)cn(CC3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C23H32N6O2S/c1-2-3-12-26-23-27-13-20-21(17-6-10-19(11-7-17)32(25,30)31)15-29(22(20)28-23)14-16-4-8-18(24)9-5-16/h6-7,10-11,13,15-16,18H,2-5,8-9,12,14,24H2,1H3,(H2,25,30,31)(H,26,27,28) |
| InChIKey | NNCZCOVYNZJFEA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|