C27H37FN6O3S — CID 71544315
7-[(4-aminocyclohexyl)methyl]-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 71544315) has the molecular formula C27H37FN6O3S and a molecular weight of 544.70 g/mol. Its IUPAC name is 7-[(4-aminocyclohexyl)methyl]-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[(4-aminocyclohexyl)methyl]-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 71544315 |
| Molecular Formula | C27H37FN6O3S |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 7-[(4-aminocyclohexyl)methyl]-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCOCC4)c(F)c3)cn(CC3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C27H37FN6O3S/c1-2-3-10-30-27-31-16-22-23(18-33(26(22)32-27)17-19-4-7-21(29)8-5-19)20-6-9-25(24(28)15-20)38(35,36)34-11-13-37-14-12-34/h6,9,15-16,18-19,21H,2-5,7-8,10-14,17,29H2,1H3,(H,30,31,32) |
| InChIKey | POJHPGOEGZTUPC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|