About 11,11-difluoro-2-(methylamino)octadecane-3,5-diol
11,11-difluoro-2-(methylamino)octadecane-3,5-diol (PubChem CID 71544621) has the molecular formula C19H39F2NO2
and a molecular weight of 351.52 g/mol. Its IUPAC name is 11,11-difluoro-2-(methylamino)octadecane-3,5-diol.
Molecular Properties
| Compound Name | 11,11-difluoro-2-(methylamino)octadecane-3,5-diol |
| PubChem CID | 71544621 |
| Molecular Formula | C19H39F2NO2 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 11,11-difluoro-2-(methylamino)octadecane-3,5-diol |
| SMILES | CCCCCCCC(F)(F)CCCCCC(O)CC(O)C(C)NC |
| InChI | InChI=1S/C19H39F2NO2/c1-4-5-6-7-10-13-19(20,21)14-11-8-9-12-17(23)15-18(24)16(2)22-3/h16-18,22-24H,4-15H2,1-3H3 |
| InChIKey | XZFIBMQLVLLXQY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11,11-difluoro-2-(methylamino)octadecane-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,11-difluoro-2-(methylamino)octadecane-3,5-diol?
The IUPAC name of 11,11-difluoro-2-(methylamino)octadecane-3,5-diol (CID 71544621) is 11,11-difluoro-2-(methylamino)octadecane-3,5-diol.
What is the SMILES notation for 11,11-difluoro-2-(methylamino)octadecane-3,5-diol?
The canonical SMILES for 11,11-difluoro-2-(methylamino)octadecane-3,5-diol is CCCCCCCC(F)(F)CCCCCC(O)CC(O)C(C)NC.
What is the InChIKey of 11,11-difluoro-2-(methylamino)octadecane-3,5-diol?
The InChIKey is XZFIBMQLVLLXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39F2NO2/c1-4-5-6-7-10-13-19(20,21)14-11-8-9-12-17(23)15-18(24)16(2)22-3/h16-18,22-24H,4-15H2,1-3H3.
What are the key properties of 11,11-difluoro-2-(methylamino)octadecane-3,5-diol?
11,11-difluoro-2-(methylamino)octadecane-3,5-diol has a molecular weight of 351.52 g/mol, XLogP of 4.65, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11,11-difluoro-2-(methylamino)octadecane-3,5-diol is sourced from PubChem (CID 71544621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).