C42H78N2 — CID 71544788
1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-4-methylpiperazine (PubChem CID 71544788) has the molecular formula C42H78N2 and a molecular weight of 611.10 g/mol. Its IUPAC name is 1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-4-methylpiperazine.
| Compound Name | 1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 71544788 |
| Molecular Formula | C42H78N2 |
| Molecular Weight | 611.10 g/mol |
| Exact Mass | 610.62 |
| IUPAC Name | 1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-4-methylpiperazine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N1CCN(C)CC1 |
| InChI | InChI=1S/C42H78N2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-42(44-40-38-43(3)39-41-44)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,42H,4-11,16-17,22-41H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | GSYJVIWJXDYYCW-QYCRHRGJSA-N |
| XLogP | 13.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.10 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|