C23H19N3O4 — CID 71544868
20-[3-(dimethylamino)propyl]-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-16-carbonitrile (PubChem CID 71544868) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 20-[3-(dimethylamino)propyl]-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-16-carbonitrile.
| Compound Name | 20-[3-(dimethylamino)propyl]-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-16-carbonitrile |
|---|---|
| PubChem CID | 71544868 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 20-[3-(dimethylamino)propyl]-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-16-carbonitrile |
| SMILES | CN(C)CCCn1c2c(c3ccc(C#N)cc3c1=O)C(=O)c1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C23H19N3O4/c1-25(2)6-3-7-26-21-15-9-18-19(30-12-29-18)10-16(15)22(27)20(21)14-5-4-13(11-24)8-17(14)23(26)28/h4-5,8-10H,3,6-7,12H2,1-2H3 |
| InChIKey | UTINZRHWKIEEPU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|