C17H24N4O — CID 7154511
(Z,3R)-1-[4-(dimethylamino)phenyl]-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-ol (PubChem CID 7154511) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is (Z,3R)-1-[4-(dimethylamino)phenyl]-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-ol.
| Compound Name | (Z,3R)-1-[4-(dimethylamino)phenyl]-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-ol |
|---|---|
| PubChem CID | 7154511 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | (Z,3R)-1-[4-(dimethylamino)phenyl]-5-methyl-2-(1,2,4-triazol-1-yl)hex-1-en-3-ol |
| SMILES | CC(C)C[C@@H](O)/C(=C/c1ccc(N(C)C)cc1)n1cncn1 |
| InChI | InChI=1S/C17H24N4O/c1-13(2)9-17(22)16(21-12-18-11-19-21)10-14-5-7-15(8-6-14)20(3)4/h5-8,10-13,17,22H,9H2,1-4H3/b16-10-/t17-/m1/s1 |
| InChIKey | ZBOFJDOCJXNNND-LPPOOGIUSA-N |
| XLogP | 2.75 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|