C19H16O5 — CID 71545369
(1S,2S,13S,15R)-8-hydroxy-15-prop-2-enyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione (PubChem CID 71545369) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is (1S,2S,13S,15R)-8-hydroxy-15-prop-2-enyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione.
| Compound Name | (1S,2S,13S,15R)-8-hydroxy-15-prop-2-enyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 71545369 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (1S,2S,13S,15R)-8-hydroxy-15-prop-2-enyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
| SMILES | C=CC[C@@]12OC[C@@H]3C[C@@H](C=C4C(=O)c5c(O)cccc5O[C@]431)C2=O |
| InChI | InChI=1S/C19H16O5/c1-2-6-18-17(22)10-7-11(9-23-18)19(18)12(8-10)16(21)15-13(20)4-3-5-14(15)24-19/h2-5,8,10-11,20H,1,6-7,9H2/t10-,11-,18-,19-/m0/s1 |
| InChIKey | WSCCRZWUYZCJAZ-GTXVLXIYSA-N |
| XLogP | 2.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|