C28H35NO5 — CID 71545376
(1S,2S,13R,15R,18R)-18-[(dipropylamino)methyl]-8-hydroxy-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione (PubChem CID 71545376) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is (1S,2S,13R,15R,18R)-18-[(dipropylamino)methyl]-8-hydroxy-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione.
| Compound Name | (1S,2S,13R,15R,18R)-18-[(dipropylamino)methyl]-8-hydroxy-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 71545376 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (1S,2S,13R,15R,18R)-18-[(dipropylamino)methyl]-8-hydroxy-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
| SMILES | CCCN(CCC)C[C@@H]1[C@H]2CO[C@@]3(CC=C(C)C)C(=O)[C@@H]1C=C1C(=O)c4c(O)cccc4O[C@]123 |
| InChI | InChI=1S/C28H35NO5/c1-5-12-29(13-6-2)15-19-18-14-20-25(31)24-22(30)8-7-9-23(24)34-28(20)21(19)16-33-27(28,26(18)32)11-10-17(3)4/h7-10,14,18-19,21,30H,5-6,11-13,15-16H2,1-4H3/t18-,19+,21-,27+,28-/m1/s1 |
| InChIKey | AMGYCBYZALRBOK-JDKZARCISA-N |
| XLogP | 4.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|