C24H42O3Si — CID 71545511
ethyl (E)-3-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate (PubChem CID 71545511) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is ethyl (E)-3-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71545511 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | ethyl (E)-3-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@H]2[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C24H42O3Si/c1-10-26-21(25)14-13-20-16(2)11-12-19-15-17(3)23(18(4)22(19)20)27-28(8,9)24(5,6)7/h11-14,16-20,22-23H,10,15H2,1-9H3/b14-13+/t16-,17+,18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | UJBZVNQUSYTJEK-YXPCQMJCSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|