C32H30FN3O4S — CID 71545520
N-[2-fluoro-5-[[14-(2-morpholin-4-ylethoxy)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]phenyl]thiophene-3-carboxamide (PubChem CID 71545520) has the molecular formula C32H30FN3O4S and a molecular weight of 571.67 g/mol. Its IUPAC name is N-[2-fluoro-5-[[14-(2-morpholin-4-ylethoxy)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-fluoro-5-[[14-(2-morpholin-4-ylethoxy)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 71545520 |
| Molecular Formula | C32H30FN3O4S |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | N-[2-fluoro-5-[[14-(2-morpholin-4-ylethoxy)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]amino]phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1cc(Nc2ccc3c(c2)CCc2ccc(OCCN4CCOCC4)cc2C3=O)ccc1F)c1ccsc1 |
| InChI | InChI=1S/C32H30FN3O4S/c33-29-8-5-25(18-30(29)35-32(38)23-9-16-41-20-23)34-24-4-7-27-22(17-24)2-1-21-3-6-26(19-28(21)31(27)37)40-15-12-36-10-13-39-14-11-36/h3-9,16-20,34H,1-2,10-15H2,(H,35,38) |
| InChIKey | QNTVPTNIYRABDR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |