C20H36O6Si — CID 71545560
cis-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)-6-oxocyclohexane-1-carboxylate (PubChem CID 71545560) has the molecular formula C20H36O6Si and a molecular weight of 400.59 g/mol. Its IUPAC name is cis-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)-6-oxocyclohexane-1-carboxylate.
| Compound Name | cis-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)-6-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71545560 |
| Molecular Formula | C20H36O6Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | cis-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)-6-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C[C@@H]1C(C(=O)OC(C)(C)C)C(=O)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O6Si/c1-19(2,3)25-18(23)17-13(12-16(22)24-7)15(11-10-14(17)21)26-27(8,9)20(4,5)6/h13,15,17H,10-12H2,1-9H3/t13-,15+,17?/m0/s1 |
| InChIKey | PCVBBNQMOBBQMN-GZJFXKPMSA-N |
| XLogP | 3.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|