C30H54N6O12 — CID 71545629
1,4,7,10,13,16-hexakis(2-methoxyethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 71545629) has the molecular formula C30H54N6O12 and a molecular weight of 690.79 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexakis(2-methoxyethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,4,7,10,13,16-hexakis(2-methoxyethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 71545629 |
| Molecular Formula | C30H54N6O12 |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.38 |
| IUPAC Name | 1,4,7,10,13,16-hexakis(2-methoxyethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | COCCN1CC(=O)N(CCOC)CC(=O)N(CCOC)CC(=O)N(CCOC)CC(=O)N(CCOC)CC(=O)N(CCOC)CC1=O |
| InChI | InChI=1S/C30H54N6O12/c1-43-13-7-31-19-26(38)33(9-15-45-3)21-28(40)35(11-17-47-5)23-30(42)36(12-18-48-6)24-29(41)34(10-16-46-4)22-27(39)32(8-14-44-2)20-25(31)37/h7-24H2,1-6H3 |
| InChIKey | XXBPDLPASFFGQB-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 177.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |