C28H48O3Si — CID 71545671
ethyl (2E,4E)-5-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-ethylpenta-2,4-dienoate (PubChem CID 71545671) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-ethylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-ethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 71545671 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | ethyl (2E,4E)-5-[(1S,2S,4aR,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-ethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C/C=C/[C@@H]1[C@H]2[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@@H]2C=C[C@@H]1C)CC |
| InChI | InChI=1S/C28H48O3Si/c1-11-22(27(29)30-12-2)14-13-15-24-19(3)16-17-23-18-20(4)26(21(5)25(23)24)31-32(9,10)28(6,7)8/h13-17,19-21,23-26H,11-12,18H2,1-10H3/b15-13+,22-14+/t19-,20+,21-,23-,24-,25-,26-/m0/s1 |
| InChIKey | GZKQAHORYXVAMH-ZSPCRUGBSA-N |
| XLogP | 7.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|