C18H27IO3 — CID 71545892
(4bS,8aS)-2-ethoxy-4b-(3-iodopropyl)-7-methyl-2,3,4,6,7,8,8a,9-octahydroindeno[2,1-b]pyran-5-one (PubChem CID 71545892) has the molecular formula C18H27IO3 and a molecular weight of 418.32 g/mol. Its IUPAC name is (4bS,8aS)-2-ethoxy-4b-(3-iodopropyl)-7-methyl-2,3,4,6,7,8,8a,9-octahydroindeno[2,1-b]pyran-5-one.
| Compound Name | (4bS,8aS)-2-ethoxy-4b-(3-iodopropyl)-7-methyl-2,3,4,6,7,8,8a,9-octahydroindeno[2,1-b]pyran-5-one |
|---|---|
| PubChem CID | 71545892 |
| Molecular Formula | C18H27IO3 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (4bS,8aS)-2-ethoxy-4b-(3-iodopropyl)-7-methyl-2,3,4,6,7,8,8a,9-octahydroindeno[2,1-b]pyran-5-one |
| SMILES | CCOC1CCC2=C(C[C@@H]3CC(C)CC(=O)[C@]23CCCI)O1 |
| InChI | InChI=1S/C18H27IO3/c1-3-21-17-6-5-14-15(22-17)11-13-9-12(2)10-16(20)18(13,14)7-4-8-19/h12-13,17H,3-11H2,1-2H3/t12?,13-,17?,18-/m0/s1 |
| InChIKey | VWVCBKVGQWLSHJ-CWURRWRDSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|