C17H23NO5 — CID 71546094
(3S,3'R,8S,8aS)-3'-methyl-3-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione (PubChem CID 71546094) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is (3S,3'R,8S,8aS)-3'-methyl-3-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione.
| Compound Name | (3S,3'R,8S,8aS)-3'-methyl-3-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 71546094 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (3S,3'R,8S,8aS)-3'-methyl-3-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione |
| SMILES | C[C@@H]1C[C@]2(CCC(=O)N3[C@H]2CC[C@H]3[C@@H]2C[C@H](C)C(=O)O2)OC1=O |
| InChI | InChI=1S/C17H23NO5/c1-9-7-12(22-15(9)20)11-3-4-13-17(6-5-14(19)18(11)13)8-10(2)16(21)23-17/h9-13H,3-8H2,1-2H3/t9-,10+,11-,12-,13-,17-/m0/s1 |
| InChIKey | FKKHBZKSDBNCSU-YDAZMWHQSA-N |
| XLogP | 1.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |