About methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate
methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate (PubChem CID 71546314) has the molecular formula C18H18N4O4
and a molecular weight of 354.37 g/mol. Its IUPAC name is methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate.
Molecular Properties
| Compound Name | methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate |
| PubChem CID | 71546314 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate |
| SMILES | COC(=O)CCCC(=O)NNC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C18H18N4O4/c1-26-17(24)8-4-7-16(23)21-22-18(25)14-9-12-11-5-2-3-6-13(11)20-15(12)10-19-14/h2-3,5-6,9-10,20H,4,7-8H2,1H3,(H,21,23)(H,22,25) |
| InChIKey | SEHBOFXYJAEUDA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate?
The IUPAC name of methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate (CID 71546314) is methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate.
What is the SMILES notation for methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate?
The canonical SMILES for methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate is COC(=O)CCCC(=O)NNC(=O)c1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate?
The InChIKey is SEHBOFXYJAEUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O4/c1-26-17(24)8-4-7-16(23)21-22-18(25)14-9-12-11-5-2-3-6-13(11)20-15(12)10-19-14/h2-3,5-6,9-10,20H,4,7-8H2,1H3,(H,21,23)(H,22,25).
What are the key properties of methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate?
methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate has a molecular weight of 354.37 g/mol, XLogP of 1.82, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-5-[2-(9H-pyrido[3,4-b]indole-3-carbonyl)hydrazinyl]pentanoate is sourced from PubChem (CID 71546314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).