C12H22NO2P — CID 71546863
(2R,6S)-2-buta-1,2-dienyl-3-tert-butyl-6-methyl-1,3,2λ5-oxazaphosphinane 2-oxide (PubChem CID 71546863) has the molecular formula C12H22NO2P and a molecular weight of 243.29 g/mol. Its IUPAC name is (2R,6S)-2-buta-1,2-dienyl-3-tert-butyl-6-methyl-1,3,2λ5-oxazaphosphinane 2-oxide.
| Compound Name | (2R,6S)-2-buta-1,2-dienyl-3-tert-butyl-6-methyl-1,3,2λ5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 71546863 |
| Molecular Formula | C12H22NO2P |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (2R,6S)-2-buta-1,2-dienyl-3-tert-butyl-6-methyl-1,3,2λ5-oxazaphosphinane 2-oxide |
| SMILES | CC=C=C[P@@]1(=O)O[C@@H](C)CCN1C(C)(C)C |
| InChI | InChI=1S/C12H22NO2P/c1-6-7-10-16(14)13(12(3,4)5)9-8-11(2)15-16/h6,10-11H,8-9H2,1-5H3/t7?,11-,16+/m0/s1 |
| InChIKey | WXGYQPMKKDIUCZ-RHXLQSLQSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|