C28H33NO3Si — CID 71546918
(1S,2S,7R,14S)-14-[tert-butyl(diphenyl)silyl]oxy-12-oxa-6-azatetracyclo[5.5.2.01,9.02,6]tetradec-9-en-11-one (PubChem CID 71546918) has the molecular formula C28H33NO3Si and a molecular weight of 459.66 g/mol. Its IUPAC name is (1S,2S,7R,14S)-14-[tert-butyl(diphenyl)silyl]oxy-12-oxa-6-azatetracyclo[5.5.2.01,9.02,6]tetradec-9-en-11-one.
| Compound Name | (1S,2S,7R,14S)-14-[tert-butyl(diphenyl)silyl]oxy-12-oxa-6-azatetracyclo[5.5.2.01,9.02,6]tetradec-9-en-11-one |
|---|---|
| PubChem CID | 71546918 |
| Molecular Formula | C28H33NO3Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (1S,2S,7R,14S)-14-[tert-butyl(diphenyl)silyl]oxy-12-oxa-6-azatetracyclo[5.5.2.01,9.02,6]tetradec-9-en-11-one |
| SMILES | CC(C)(C)[Si](O[C@H]1C[C@]23OC(=O)C=C2C[C@H]1N1CCC[C@H]13)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO3Si/c1-27(2,3)33(21-11-6-4-7-12-21,22-13-8-5-9-14-22)32-24-19-28-20(18-26(30)31-28)17-23(24)29-16-10-15-25(28)29/h4-9,11-14,18,23-25H,10,15-17,19H2,1-3H3/t23-,24+,25+,28+/m1/s1 |
| InChIKey | QSMJVCWSNKLGFJ-RBOWJBJUSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|