C21H18N2O4 — CID 71546982
ethyl 2-[(6-methyl-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl)amino]acetate (PubChem CID 71546982) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl 2-[(6-methyl-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl)amino]acetate.
| Compound Name | ethyl 2-[(6-methyl-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl)amino]acetate |
|---|---|
| PubChem CID | 71546982 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl 2-[(6-methyl-5,11-dioxoindeno[1,2-c]isoquinolin-3-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1ccc2c3c(n(C)c(=O)c2c1)-c1ccccc1C3=O |
| InChI | InChI=1S/C21H18N2O4/c1-3-27-17(24)11-22-12-8-9-13-16(10-12)21(26)23(2)19-14-6-4-5-7-15(14)20(25)18(13)19/h4-10,22H,3,11H2,1-2H3 |
| InChIKey | OMLYGEAZQULWPI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|