C25H42O2Si — CID 71547055
(1aR,1bS,3aS,7aS,7bR,9aS)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one (PubChem CID 71547055) has the molecular formula C25H42O2Si and a molecular weight of 402.70 g/mol. Its IUPAC name is (1aR,1bS,3aS,7aS,7bR,9aS)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one.
| Compound Name | (1aR,1bS,3aS,7aS,7bR,9aS)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one |
|---|---|
| PubChem CID | 71547055 |
| Molecular Formula | C25H42O2Si |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (1aR,1bS,3aS,7aS,7bR,9aS)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,5,7b-tetramethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one |
| SMILES | CC1=CC[C@H]2[C@]3(C)CC[C@]4(O[Si](C)(C)C(C)(C)C)C[C@]4(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C25H42O2Si/c1-17-10-11-18-22(5)14-15-25(27-28(8,9)21(2,3)4)16-24(25,7)19(22)12-13-23(18,6)20(17)26/h10,18-19H,11-16H2,1-9H3/t18-,19-,22-,23-,24+,25-/m0/s1 |
| InChIKey | RFSQYPXIKLPRFP-BCZBAPJOSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|