C18H18ClN5O2 — CID 71547115
6-butyl-7-(2-chlorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 71547115) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 6-butyl-7-(2-chlorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-butyl-7-(2-chlorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 71547115 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 6-butyl-7-(2-chlorophenyl)-4-methylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCn1c(-c2ccccc2Cl)cn2c3c(=O)[nH]c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C18H18ClN5O2/c1-3-4-9-23-13(11-7-5-6-8-12(11)19)10-24-14-15(20-17(23)24)22(2)18(26)21-16(14)25/h5-8,10H,3-4,9H2,1-2H3,(H,21,25,26) |
| InChIKey | BTQRVKVBNPVBAC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |