C14H16ClN7 — CID 71547282
12-chloro-7-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 71547282) has the molecular formula C14H16ClN7 and a molecular weight of 317.78 g/mol. Its IUPAC name is 12-chloro-7-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 12-chloro-7-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 71547282 |
| Molecular Formula | C14H16ClN7 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 12-chloro-7-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | C[C@H]1CN(c2nc3ncc(Cl)cc3n3cnnc23)CCN1C |
| InChI | InChI=1S/C14H16ClN7/c1-9-7-21(4-3-20(9)2)13-14-19-17-8-22(14)11-5-10(15)6-16-12(11)18-13/h5-6,8-9H,3-4,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | MLLMVCNLOSRTGN-VIFPVBQESA-N |
| XLogP | 1.47 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |