C25H31N5O4S — CID 71547350
N-hydroxy-4-[4-[4-(4-pentylphenyl)triazol-1-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 71547350) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(4-pentylphenyl)triazol-1-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(4-pentylphenyl)triazol-1-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 71547350 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-hydroxy-4-[4-[4-(4-pentylphenyl)triazol-1-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCCCCc1ccc(-c2cn(-c3ccc(S(=O)(=O)C4(C(=O)NO)CCNCC4)cc3)nn2)cc1 |
| InChI | InChI=1S/C25H31N5O4S/c1-2-3-4-5-19-6-8-20(9-7-19)23-18-30(29-27-23)21-10-12-22(13-11-21)35(33,34)25(24(31)28-32)14-16-26-17-15-25/h6-13,18,26,32H,2-5,14-17H2,1H3,(H,28,31) |
| InChIKey | CGJSNCTVBFVXRC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|