C52H76N4O8+4 — CID 71547364
trimethyl-[4-[4,9,10-tris[4-(trimethylazaniumyl)butoxycarbonyl]perylene-3-carbonyl]oxybutyl]azanium (PubChem CID 71547364) has the molecular formula C52H76N4O8+4 and a molecular weight of 885.20 g/mol. Its IUPAC name is trimethyl-[4-[4,9,10-tris[4-(trimethylazaniumyl)butoxycarbonyl]perylene-3-carbonyl]oxybutyl]azanium.
| Compound Name | trimethyl-[4-[4,9,10-tris[4-(trimethylazaniumyl)butoxycarbonyl]perylene-3-carbonyl]oxybutyl]azanium |
|---|---|
| PubChem CID | 71547364 |
| Molecular Formula | C52H76N4O8+4 |
| Molecular Weight | 885.20 g/mol |
| Exact Mass | 884.56 |
| IUPAC Name | trimethyl-[4-[4,9,10-tris[4-(trimethylazaniumyl)butoxycarbonyl]perylene-3-carbonyl]oxybutyl]azanium |
| SMILES | C[N+](C)(C)CCCCOC(=O)c1ccc2c3ccc(C(=O)OCCCC[N+](C)(C)C)c4c(C(=O)OCCCC[N+](C)(C)C)ccc(c5ccc(C(=O)OCCCC[N+](C)(C)C)c1c25)c43 |
| InChI | InChI=1S/C52H76N4O8/c1-53(2,3)29-13-17-33-61-49(57)41-25-21-37-39-23-27-43(51(59)63-35-19-15-31-55(7,8)9)48-44(52(60)64-36-20-16-32-56(10,11)12)28-24-40(46(39)48)38-22-26-42(47(41)45(37)38)50(58)62-34-18-14-30-54(4,5)6/h21-28H,13-20,29-36H2,1-12H3/q+4 |
| InChIKey | LRMIQIIAPYHYFR-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.20 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|