C25H29FN2O5 — CID 71547427
(1S,5S,17R,18S,23S,26R)-10-fluoro-20,20-dimethyl-25-oxa-7,14-diazaheptacyclo[15.6.2.15,16.01,19.02,16.06,15.08,13]hexacosa-6,8(13),9,11,14-pentaene-17,18,23,26-tetrol (PubChem CID 71547427) has the molecular formula C25H29FN2O5 and a molecular weight of 456.51 g/mol. Its IUPAC name is (1S,5S,17R,18S,23S,26R)-10-fluoro-20,20-dimethyl-25-oxa-7,14-diazaheptacyclo[15.6.2.15,16.01,19.02,16.06,15.08,13]hexacosa-6,8(13),9,11,14-pentaene-17,18,23,26-tetrol.
| Compound Name | (1S,5S,17R,18S,23S,26R)-10-fluoro-20,20-dimethyl-25-oxa-7,14-diazaheptacyclo[15.6.2.15,16.01,19.02,16.06,15.08,13]hexacosa-6,8(13),9,11,14-pentaene-17,18,23,26-tetrol |
|---|---|
| PubChem CID | 71547427 |
| Molecular Formula | C25H29FN2O5 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (1S,5S,17R,18S,23S,26R)-10-fluoro-20,20-dimethyl-25-oxa-7,14-diazaheptacyclo[15.6.2.15,16.01,19.02,16.06,15.08,13]hexacosa-6,8(13),9,11,14-pentaene-17,18,23,26-tetrol |
| SMILES | CC1(C)CC[C@H](O)[C@]23CO[C@@](O)([C@@H](O)C12)C12c4nc5ccc(F)cc5nc4[C@H](CCC13)[C@H]2O |
| InChI | InChI=1S/C25H29FN2O5/c1-22(2)8-7-16(29)23-10-33-25(32,21(31)18(22)23)24-15(23)6-4-12(20(24)30)17-19(24)28-13-5-3-11(26)9-14(13)27-17/h3,5,9,12,15-16,18,20-21,29-32H,4,6-8,10H2,1-2H3/t12-,15?,16-,18?,20+,21-,23+,24?,25-/m0/s1 |
| InChIKey | SIYZQDZFBJLUEK-JGFORFBZSA-N |
| XLogP | 1.75 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |