C20H20ClF3N4O — CID 71547637
[(7S,8aS)-7-[(5-chloro-2-pyridinyl)amino]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 71547637) has the molecular formula C20H20ClF3N4O and a molecular weight of 424.85 g/mol. Its IUPAC name is [(7S,8aS)-7-[(5-chloro-2-pyridinyl)amino]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(7S,8aS)-7-[(5-chloro-2-pyridinyl)amino]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 71547637 |
| Molecular Formula | C20H20ClF3N4O |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [(7S,8aS)-7-[(5-chloro-2-pyridinyl)amino]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCN2C[C@@H](Nc3ccc(Cl)cn3)C[C@H]2C1 |
| InChI | InChI=1S/C20H20ClF3N4O/c21-15-4-5-18(25-10-15)26-16-9-17-12-28(7-6-27(17)11-16)19(29)13-2-1-3-14(8-13)20(22,23)24/h1-5,8,10,16-17H,6-7,9,11-12H2,(H,25,26)/t16-,17-/m0/s1 |
| InChIKey | UKSDGLVEARKRPC-IRXDYDNUSA-N |
| XLogP | 3.76 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |