C13H13Cl2N7 — CID 71547762
11,12-dichloro-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 71547762) has the molecular formula C13H13Cl2N7 and a molecular weight of 338.20 g/mol. Its IUPAC name is 11,12-dichloro-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 11,12-dichloro-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 71547762 |
| Molecular Formula | C13H13Cl2N7 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 11,12-dichloro-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | CN1CCN(c2nc3nc(Cl)c(Cl)cc3n3cnnc23)CC1 |
| InChI | InChI=1S/C13H13Cl2N7/c1-20-2-4-21(5-3-20)12-13-19-16-7-22(13)9-6-8(14)10(15)17-11(9)18-12/h6-7H,2-5H2,1H3 |
| InChIKey | MYRLDCFZZRCYHU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|