C13H14ClN7 — CID 71547932
12-chloro-7-(4-methylpiperazin-1-yl)-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 71547932) has the molecular formula C13H14ClN7 and a molecular weight of 303.76 g/mol. Its IUPAC name is 12-chloro-7-(4-methylpiperazin-1-yl)-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 12-chloro-7-(4-methylpiperazin-1-yl)-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 71547932 |
| Molecular Formula | C13H14ClN7 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 12-chloro-7-(4-methylpiperazin-1-yl)-3,5,6,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | CN1CCN(c2nc3ncc(Cl)cc3c3ncnn23)CC1 |
| InChI | InChI=1S/C13H14ClN7/c1-19-2-4-20(5-3-19)13-18-11-10(6-9(14)7-15-11)12-16-8-17-21(12)13/h6-8H,2-5H2,1H3 |
| InChIKey | JAXUIZVKVLIYLB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |