C16H17FN2O4 — CID 71548060
N-[3-(3-fluorophenoxy)propyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide (PubChem CID 71548060) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is N-[3-(3-fluorophenoxy)propyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide.
| Compound Name | N-[3-(3-fluorophenoxy)propyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 71548060 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[3-(3-fluorophenoxy)propyl]-3-hydroxy-1-methyl-2-oxopyridine-4-carboxamide |
| SMILES | Cn1ccc(C(=O)NCCCOc2cccc(F)c2)c(O)c1=O |
| InChI | InChI=1S/C16H17FN2O4/c1-19-8-6-13(14(20)16(19)22)15(21)18-7-3-9-23-12-5-2-4-11(17)10-12/h2,4-6,8,10,20H,3,7,9H2,1H3,(H,18,21) |
| InChIKey | NXRQRTOUEUAHCD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|