C12H13ClN8 — CID 71548411
12-chloro-7-(4-methylpiperazin-1-yl)-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 71548411) has the molecular formula C12H13ClN8 and a molecular weight of 304.75 g/mol. Its IUPAC name is 12-chloro-7-(4-methylpiperazin-1-yl)-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 12-chloro-7-(4-methylpiperazin-1-yl)-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 71548411 |
| Molecular Formula | C12H13ClN8 |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 12-chloro-7-(4-methylpiperazin-1-yl)-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | CN1CCN(c2nc3ncc(Cl)cc3n3nnnc23)CC1 |
| InChI | InChI=1S/C12H13ClN8/c1-19-2-4-20(5-3-19)11-12-16-17-18-21(12)9-6-8(13)7-14-10(9)15-11/h6-7H,2-5H2,1H3 |
| InChIKey | LCTNQWHKGUJFEH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 75.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |