C22H26N5O4P — CID 71548461
[3-[(R)-cyclohexyl-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]-methylphosphinic acid (PubChem CID 71548461) has the molecular formula C22H26N5O4P and a molecular weight of 455.46 g/mol. Its IUPAC name is [3-[(R)-cyclohexyl-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]-methylphosphinic acid.
| Compound Name | [3-[(R)-cyclohexyl-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 71548461 |
| Molecular Formula | C22H26N5O4P |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [3-[(R)-cyclohexyl-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]methyl]phenyl]-methylphosphinic acid |
| SMILES | CP(=O)(O)c1cccc([C@H](NC(=O)c2cnc(-n3cccn3)[nH]c2=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H26N5O4P/c1-32(30,31)17-10-5-9-16(13-17)19(15-7-3-2-4-8-15)25-20(28)18-14-23-22(26-21(18)29)27-12-6-11-24-27/h5-6,9-15,19H,2-4,7-8H2,1H3,(H,25,28)(H,30,31)(H,23,26,29)/t19-/m1/s1 |
| InChIKey | KIPSEUKUPQOSOW-LJQANCHMSA-N |
| XLogP | 2.53 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|