C12H12N8O2 — CID 71548591
N-methyl-1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-amine (PubChem CID 71548591) has the molecular formula C12H12N8O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is N-methyl-1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-amine.
| Compound Name | N-methyl-1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-amine |
|---|---|
| PubChem CID | 71548591 |
| Molecular Formula | C12H12N8O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-methyl-1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-amine |
| SMILES | CNC1CN(c2nc3ncc([N+](=O)[O-])cc3n3cnnc23)C1 |
| InChI | InChI=1S/C12H12N8O2/c1-13-7-4-18(5-7)11-12-17-15-6-19(12)9-2-8(20(21)22)3-14-10(9)16-11/h2-3,6-7,13H,4-5H2,1H3 |
| InChIKey | MSBQKMIKJYWQLY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|