C16H15N7O — CID 71548594
1-[12-(furan-2-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]-N-methylazetidin-3-amine (PubChem CID 71548594) has the molecular formula C16H15N7O and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-[12-(furan-2-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]-N-methylazetidin-3-amine.
| Compound Name | 1-[12-(furan-2-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]-N-methylazetidin-3-amine |
|---|---|
| PubChem CID | 71548594 |
| Molecular Formula | C16H15N7O |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[12-(furan-2-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl]-N-methylazetidin-3-amine |
| SMILES | CNC1CN(c2nc3ncc(-c4ccco4)cc3n3cnnc23)C1 |
| InChI | InChI=1S/C16H15N7O/c1-17-11-7-22(8-11)15-16-21-19-9-23(16)12-5-10(6-18-14(12)20-15)13-3-2-4-24-13/h2-6,9,11,17H,7-8H2,1H3 |
| InChIKey | HCOFYFDBWVOHQU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |