C18H21N3O8 — CID 71548890
4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]morpholin-3-one;(E)-but-2-enedioic acid (PubChem CID 71548890) has the molecular formula C18H21N3O8 and a molecular weight of 407.38 g/mol. Its IUPAC name is 4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]morpholin-3-one;(E)-but-2-enedioic acid.
| Compound Name | 4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]morpholin-3-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 71548890 |
| Molecular Formula | C18H21N3O8 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]morpholin-3-one;(E)-but-2-enedioic acid |
| SMILES | NC[C@H]1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H17N3O4.C4H4O4/c15-7-12-8-17(14(19)21-12)11-3-1-10(2-4-11)16-5-6-20-9-13(16)18;5-3(6)1-2-4(7)8/h1-4,12H,5-9,15H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t12-;/m0./s1 |
| InChIKey | XYBTVASYJLRQEI-GYDOPSIJSA-N |
| XLogP | 0.05 |
| TPSA | 159.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|