C28H28N2O3 — CID 71548930
4-(3-aminophenyl)-5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]chromen-2-one (PubChem CID 71548930) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-(3-aminophenyl)-5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]chromen-2-one.
| Compound Name | 4-(3-aminophenyl)-5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 71548930 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-(3-aminophenyl)-5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(-c3cccc(N)c3)c2c(C)c1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C28H28N2O3/c1-18-14-25-28(24(16-26(31)33-25)22-4-3-5-23(29)15-22)19(2)27(18)21-8-6-20(7-9-21)17-30-10-12-32-13-11-30/h3-9,14-16H,10-13,17,29H2,1-2H3 |
| InChIKey | YPQNZMSVZYWEFI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|